Organooxygen compounds
Aobchem 5-Chloro-2-ethoxybenzaldehyde | ≥97% | CAS 27682-64-0 | C9H9ClO2 | 1g
5-Chloro-2-ethoxybenzaldehyde | ≥97% | CAS 27682-64-0 | C9H9ClO2 | 1g
Aobchem 2 3-Difluoro-6-hydroxybenzaldehyde | ≥97% | CAS 187543-89-1 | C7H4F2O2 | 250mg
2 3-Difluoro-6-hydroxybenzaldehyde | ≥97% | CAS 187543-89-1 | C7H4F2O2 | 250mg
eMolecules 98020-38-3 | 2-Aminothiazole-4-carbaldehyde | MFCD07787389 | 250mg
Ambeed | 2-Aminothiazole-4-carbaldehyde | 250mg | 602850587 | A701396 | 98020-38-3 | MFCD07787389 | 128.150 | C4H4N2OS
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 175592-59-3 | 2-Formylthiophene-4-boronic acid | Ambeed | MFCD03002365 | 155.960 | C5H5BO3S | 97.000 | OB(O)c1csc(C=O)c1 | 250mg | 521421236
2-Formylthiophene-4-boronic acid | Ambeed | 175592-59-3 | MFCD03002365 | 155.960 | C5H5BO3S | 97.000 | OB(O)c1csc(C=O)c1 | 250mg | 521421236
eMolecules 57771-09-2 | 4-(Dibutylamino)salicylaldehyde | Combi-Blocks | MFCD08276356 | 249.354 | C15H23NO2 | 95.000 | CCCCN(CCCC)c1ccc(C=O)c(O)c1 | 1g | 267201890
4-(Dibutylamino)salicylaldehyde | Combi-Blocks | 57771-09-2 | MFCD08276356 | 249.354 | C15H23NO2 | 95.000 | CCCCN(CCCC)c1ccc(C=O)c(O)c1 | 1g | 267201890
Medchemexpress LLC HY-W007376 100mg Medchemexpress, Indole-3-carboxaldehyde CAS:487-89-8 Purity:>98%
Medchemexpress, HY-W007376 100mg Indole-3-carboxaldehyde CAS:487-89-8 Indole-3-carboxaldehyde (3-Formylindole), a cabbage extract, is the product of the oxidative degradation of indole-3-acetic acid (IAA) by crude enzyme preparations from etiolated pea seedlings. Indole-3-carboxaldehyde (3-Formylindole) is a biochemical used to prepare analogs of the indole phytoalexin cyclobrassinin. Purity:>98% Medchemexpress has over 10000 novel life-science reagents, reference compounds, APIs and natural compounds for laboratory and scientific use. Other quantity can also be offered.
eMolecules 614-65-3 | 2-Hydroxybenzaldehyde phenylhydrazone | Combi-Blocks, Inc. | MFCD00136159 | 212.252 | C13H12N2O | 97.000 | Oc1ccccc1\C=N\Nc1ccccc1 | 25g | 586078596
2-Hydroxybenzaldehyde phenylhydrazone | Combi-Blocks, Inc. | 614-65-3 | MFCD00136159 | 212.252 | C13H12N2O | 97.000 | Oc1ccccc1\C=N\Nc1ccccc1 | 25g | 586078596
eMolecules 2433-85-4 | 4,5-Dibromo-2-furaldehyde | Combi-Blocks | MFCD00658947 | 253.877 | C5H2Br2O2 | 98.000 | Brc1cc(C=O)oc1Br | 1g | 335360755
4,5-Dibromo-2-furaldehyde | Combi-Blocks | 2433-85-4 | MFCD00658947 | 253.877 | C5H2Br2O2 | 98.000 | Brc1cc(C=O)oc1Br | 1g | 335360755
eMolecules 13803-39-9 | 5-Phenyl-2-furaldehyde | Combi-Blocks | MFCD01910161 | 172.183 | C11H8O2 | 98.000 | O=Cc1ccc(o1)-c1ccccc1 | 25g | 457919130
5-Phenyl-2-furaldehyde | Combi-Blocks | 13803-39-9 | MFCD01910161 | 172.183 | C11H8O2 | 98.000 | O=Cc1ccc(o1)-c1ccccc1 | 25g | 457919130
eMolecules 22924-15-8 | Ambeed | 3-Ethoxybenzaldehyde | 5g | 600851792 | A796945 | MFCD00016606 | 150.177 | C9H10O2
Medchem Express | 2-O-Galloylhyperin | 5mg | 510477771 | HY-N0526 | 53209-27-1 | MFCD07781428 | 616.484 | C28H24O16
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
Matrix Scientific 4-(DIFLUOROMETHOXY)BENZALDE-5G
4-(Difluoromethoxy)benzaldehyde, 98%; 5g,C8H6F2O2, MFCD00042252, mw 172.13, [73960-07-3]
eMolecules 1289208-00-9 | 2-Bromo-3-formylbenzoic acid | Apollo Scientific | MFCD28357159 | 229.029 | C8H5BrO3 | 95.000 | OC(=O)c1cccc(C=O)c1Br | 1g | 562431593
2-Bromo-3-formylbenzoic acid | Apollo Scientific | 1289208-00-9 | MFCD28357159 | 229.029 | C8H5BrO3 | 95.000 | OC(=O)c1cccc(C=O)c1Br | 1g | 562431593
eMolecules 73289-79-9 | 5-Formyl-2-hydroxybenzonitrile | MFCD16999751 | 1g
Ambeed | 5-Formyl-2-hydroxybenzonitrile | 1g | 525191255 | A341332 | 73289-79-9 | MFCD16999751 | 147.133 | C8H5NO2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 448961-58-8 | 4-HYDROXY-2,3-DIMETHYLBENZONITRILE | MFCD13659357 | 1g
Ambeed | 2-(4455-Tetramethyl-132-dioxaborolan-2-yl)benzo[b]thiophene-5-carbaldehyde | 100mg | 742300463 | A772581 | 953410-99-6 | MFCD07368240 | 288.170 | C15H17BO3S
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool